C8H3ClF3IN2 — CID 134450080
8-chloro-7-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 134450080) has the molecular formula C8H3ClF3IN2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 8-chloro-7-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-chloro-7-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 134450080 |
| Molecular Formula | C8H3ClF3IN2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 8-chloro-7-iodo-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | FC(F)(F)c1cn2ccc(I)c(Cl)c2n1 |
| InChI | InChI=1S/C8H3ClF3IN2/c9-6-4(13)1-2-15-3-5(8(10,11)12)14-7(6)15/h1-3H |
| InChIKey | ONIBCCKEYURVLZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|