C36H51F3O3 — CID 134451805
[(4R)-1-cyclohexyl-4-[(1S,2S,5R,6R,9S,10R,13S)-13-hydroxy-6,10-dimethyl-13-(trifluoromethyl)-5-tetracyclo[7.6.0.02,6.010,14]pentadecanyl]pentyl] benzoate (PubChem CID 134451805) has the molecular formula C36H51F3O3 and a molecular weight of 588.80 g/mol. Its IUPAC name is [(4R)-1-cyclohexyl-4-[(1S,2S,5R,6R,9S,10R,13S)-13-hydroxy-6,10-dimethyl-13-(trifluoromethyl)-5-tetracyclo[7.6.0.02,6.010,14]pentadecanyl]pentyl] benzoate.
| Compound Name | [(4R)-1-cyclohexyl-4-[(1S,2S,5R,6R,9S,10R,13S)-13-hydroxy-6,10-dimethyl-13-(trifluoromethyl)-5-tetracyclo[7.6.0.02,6.010,14]pentadecanyl]pentyl] benzoate |
|---|---|
| PubChem CID | 134451805 |
| Molecular Formula | C36H51F3O3 |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | [(4R)-1-cyclohexyl-4-[(1S,2S,5R,6R,9S,10R,13S)-13-hydroxy-6,10-dimethyl-13-(trifluoromethyl)-5-tetracyclo[7.6.0.02,6.010,14]pentadecanyl]pentyl] benzoate |
| SMILES | C[C@H](CCC(OC(=O)c1ccccc1)C1CCCCC1)[C@H]1CC[C@H]2[C@@H]3CC4[C@](C)(CC[C@@]4(O)C(F)(F)F)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H51F3O3/c1-23(14-17-30(24-10-6-4-7-11-24)42-32(40)25-12-8-5-9-13-25)27-15-16-28-26-22-31-34(3,29(26)18-19-33(27,28)2)20-21-35(31,41)36(37,38)39/h5,8-9,12-13,23-24,26-31,41H,4,6-7,10-11,14-22H2,1-3H3/t23-,26+,27-,28+,29+,30?,31?,33-,34-,35+/m1/s1 |
| InChIKey | LSCGBFJMAQBQCG-BTDCEEBBSA-N |
| XLogP | 9.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |