C31H51F3O2 — CID 170249601
(1S,2S,5R,6R,9S,10R,13S)-5-[(2R)-4-(1-hydroxy-4-propan-2-ylcyclohexyl)butan-2-yl]-6,10-dimethyl-13-(trifluoromethyl)tetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol (PubChem CID 170249601) has the molecular formula C31H51F3O2 and a molecular weight of 512.74 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S)-5-[(2R)-4-(1-hydroxy-4-propan-2-ylcyclohexyl)butan-2-yl]-6,10-dimethyl-13-(trifluoromethyl)tetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S)-5-[(2R)-4-(1-hydroxy-4-propan-2-ylcyclohexyl)butan-2-yl]-6,10-dimethyl-13-(trifluoromethyl)tetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol |
|---|---|
| PubChem CID | 170249601 |
| Molecular Formula | C31H51F3O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S)-5-[(2R)-4-(1-hydroxy-4-propan-2-ylcyclohexyl)butan-2-yl]-6,10-dimethyl-13-(trifluoromethyl)tetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol |
| SMILES | CC(C)C1CCC(O)(CC[C@@H](C)[C@H]2CC[C@H]3[C@@H]4CC5[C@](C)(CC[C@@]5(O)C(F)(F)F)[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C31H51F3O2/c1-19(2)21-9-14-29(35,15-10-21)13-8-20(3)23-6-7-24-22-18-26-28(5,25(22)11-12-27(23,24)4)16-17-30(26,36)31(32,33)34/h19-26,35-36H,6-18H2,1-5H3/t20-,21?,22+,23-,24+,25+,26?,27-,28-,29?,30+/m1/s1 |
| InChIKey | PPUVIAKIQWQKFT-YEGTYCQGSA-N |
| XLogP | 8.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |