C25H31F3N6 — CID 134453542
6-[(6S,8R)-7-(2,2-difluoroethyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine (PubChem CID 134453542) has the molecular formula C25H31F3N6 and a molecular weight of 472.56 g/mol. Its IUPAC name is 6-[(6S,8R)-7-(2,2-difluoroethyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S,8R)-7-(2,2-difluoroethyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 134453542 |
| Molecular Formula | C25H31F3N6 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 6-[(6S,8R)-7-(2,2-difluoroethyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@](C)(c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)F |
| InChI | InChI=1S/C25H31F3N6/c1-16-10-19-20-12-30-32-22(20)6-5-21(19)25(2,34(16)15-24(27)28)23-7-4-17(11-29-23)31-18-13-33(14-18)9-3-8-26/h4-7,11-12,16,18,24,31H,3,8-10,13-15H2,1-2H3,(H,30,32)/t16-,25+/m1/s1 |
| InChIKey | RVVNCNQGXBSLJG-CPJLOUKISA-N |
| XLogP | 4.19 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |