C23H19Cl2F3N4O4 — CID 134457556
N-[2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 134457556) has the molecular formula C23H19Cl2F3N4O4 and a molecular weight of 543.33 g/mol. Its IUPAC name is N-[2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134457556 |
| Molecular Formula | C23H19Cl2F3N4O4 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | N-[2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C(F)(F)F)c1Nc1ncc(OCc2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C23H19Cl2F3N4O4/c1-4-18(33)31-15-7-5-6-14(23(26,27)28)21(15)32-22-29-9-12(10-30-22)36-11-13-19(24)16(34-2)8-17(35-3)20(13)25/h4-10H,1,11H2,2-3H3,(H,31,33)(H,29,30,32) |
| InChIKey | XONCYYYZIPHCHO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|