C10H13NS — CID 134457648
2,3-bis[(Z)-prop-1-enyl]-4H-1,4-thiazine (PubChem CID 134457648) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 2,3-bis[(Z)-prop-1-enyl]-4H-1,4-thiazine.
| Compound Name | 2,3-bis[(Z)-prop-1-enyl]-4H-1,4-thiazine |
|---|---|
| PubChem CID | 134457648 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2,3-bis[(Z)-prop-1-enyl]-4H-1,4-thiazine |
| SMILES | C/C=C\C1=C(/C=C\C)SC=CN1 |
| InChI | InChI=1S/C10H13NS/c1-3-5-9-10(6-4-2)12-8-7-11-9/h3-8,11H,1-2H3/b5-3-,6-4- |
| InChIKey | ICMBETQUQHQWNA-GLIMQPGKSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |