C13H20N4 — CID 134458210
2-N-ethenyl-2-N-[(Z)-hexan-2-ylideneamino]pyridine-2,5-diamine (PubChem CID 134458210) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-N-ethenyl-2-N-[(Z)-hexan-2-ylideneamino]pyridine-2,5-diamine.
| Compound Name | 2-N-ethenyl-2-N-[(Z)-hexan-2-ylideneamino]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 134458210 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-N-ethenyl-2-N-[(Z)-hexan-2-ylideneamino]pyridine-2,5-diamine |
| SMILES | C=CN(/N=C(/C)CCCC)c1ccc(N)cn1 |
| InChI | InChI=1S/C13H20N4/c1-4-6-7-11(3)16-17(5-2)13-9-8-12(14)10-15-13/h5,8-10H,2,4,6-7,14H2,1,3H3/b16-11- |
| InChIKey | OPBSBSQOAZDEHX-WJDWOHSUSA-N |
| XLogP | 3.18 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|