C12H24O4 — CID 13445927
4,6,6-triethoxyhexan-2-one (PubChem CID 13445927) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,6,6-triethoxyhexan-2-one.
| Compound Name | 4,6,6-triethoxyhexan-2-one |
|---|---|
| PubChem CID | 13445927 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,6,6-triethoxyhexan-2-one |
| SMILES | CCOC(CC(C)=O)CC(OCC)OCC |
| InChI | InChI=1S/C12H24O4/c1-5-14-11(8-10(4)13)9-12(15-6-2)16-7-3/h11-12H,5-9H2,1-4H3 |
| InChIKey | OBKMSHGEQMPBEW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|