C10H18O4 — CID 139993973
1,1-diethoxyhexane-2,3-dione (PubChem CID 139993973) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,1-diethoxyhexane-2,3-dione.
| Compound Name | 1,1-diethoxyhexane-2,3-dione |
|---|---|
| PubChem CID | 139993973 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1,1-diethoxyhexane-2,3-dione |
| SMILES | CCCC(=O)C(=O)C(OCC)OCC |
| InChI | InChI=1S/C10H18O4/c1-4-7-8(11)9(12)10(13-5-2)14-6-3/h10H,4-7H2,1-3H3 |
| InChIKey | GOXCTVAGUMHPGN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|