About 3-oxo-5,5-di(propan-2-yloxy)pentanal
3-oxo-5,5-di(propan-2-yloxy)pentanal (PubChem CID 23144796) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-oxo-5,5-di(propan-2-yloxy)pentanal.
Molecular Properties
| Compound Name | 3-oxo-5,5-di(propan-2-yloxy)pentanal |
| PubChem CID | 23144796 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-oxo-5,5-di(propan-2-yloxy)pentanal |
| SMILES | CC(C)OC(CC(=O)CC=O)OC(C)C |
| InChI | InChI=1S/C11H20O4/c1-8(2)14-11(15-9(3)4)7-10(13)5-6-12/h6,8-9,11H,5,7H2,1-4H3 |
| InChIKey | MWXCNDHLJOCRNB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-5,5-di(propan-2-yloxy)pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-5,5-di(propan-2-yloxy)pentanal?
The IUPAC name of 3-oxo-5,5-di(propan-2-yloxy)pentanal (CID 23144796) is 3-oxo-5,5-di(propan-2-yloxy)pentanal.
What is the SMILES notation for 3-oxo-5,5-di(propan-2-yloxy)pentanal?
The canonical SMILES for 3-oxo-5,5-di(propan-2-yloxy)pentanal is CC(C)OC(CC(=O)CC=O)OC(C)C.
What is the InChIKey of 3-oxo-5,5-di(propan-2-yloxy)pentanal?
The InChIKey is MWXCNDHLJOCRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-8(2)14-11(15-9(3)4)7-10(13)5-6-12/h6,8-9,11H,5,7H2,1-4H3.
What are the key properties of 3-oxo-5,5-di(propan-2-yloxy)pentanal?
3-oxo-5,5-di(propan-2-yloxy)pentanal has a molecular weight of 216.28 g/mol, XLogP of 1.71, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-5,5-di(propan-2-yloxy)pentanal is sourced from PubChem (CID 23144796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).