C9H8N2O2 — CID 134462968
(3-methylimidazo[1,2-a]pyridin-2-yl) formate (PubChem CID 134462968) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is (3-methylimidazo[1,2-a]pyridin-2-yl) formate.
| Compound Name | (3-methylimidazo[1,2-a]pyridin-2-yl) formate |
|---|---|
| PubChem CID | 134462968 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (3-methylimidazo[1,2-a]pyridin-2-yl) formate |
| SMILES | Cc1c(OC=O)nc2ccccn12 |
| InChI | InChI=1S/C9H8N2O2/c1-7-9(13-6-12)10-8-4-2-3-5-11(7)8/h2-6H,1H3 |
| InChIKey | WNCBKSLVLIKUOZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|