C15H19FO3 — CID 134466095
methyl 3-cyclopropyl-2-fluoro-3-(3-methoxyphenyl)-2-methylpropanoate (PubChem CID 134466095) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is methyl 3-cyclopropyl-2-fluoro-3-(3-methoxyphenyl)-2-methylpropanoate.
| Compound Name | methyl 3-cyclopropyl-2-fluoro-3-(3-methoxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 134466095 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 3-cyclopropyl-2-fluoro-3-(3-methoxyphenyl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(F)C(c1cccc(OC)c1)C1CC1 |
| InChI | InChI=1S/C15H19FO3/c1-15(16,14(17)19-3)13(10-7-8-10)11-5-4-6-12(9-11)18-2/h4-6,9-10,13H,7-8H2,1-3H3 |
| InChIKey | FJQZOWXKPJVKNA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |