C15H16F4O5S — CID 146316666
methyl (3S)-3-cyclopropyl-2-fluoro-2-methyl-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 146316666) has the molecular formula C15H16F4O5S and a molecular weight of 384.35 g/mol. Its IUPAC name is methyl (3S)-3-cyclopropyl-2-fluoro-2-methyl-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-cyclopropyl-2-fluoro-2-methyl-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 146316666 |
| Molecular Formula | C15H16F4O5S |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl (3S)-3-cyclopropyl-2-fluoro-2-methyl-3-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | COC(=O)C(C)(F)[C@H](c1cccc(OS(=O)(=O)C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C15H16F4O5S/c1-14(16,13(20)23-2)12(9-6-7-9)10-4-3-5-11(8-10)24-25(21,22)15(17,18)19/h3-5,8-9,12H,6-7H2,1-2H3/t12-,14?/m0/s1 |
| InChIKey | ZYWJYAQYTSJWHA-NBFOIZRFSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|