C20H31FO3Si — CID 151278311
methyl (3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate (PubChem CID 151278311) has the molecular formula C20H31FO3Si and a molecular weight of 366.55 g/mol. Its IUPAC name is methyl (3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate.
| Compound Name | methyl (3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 151278311 |
| Molecular Formula | C20H31FO3Si |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-cyclopropyl-2-fluoro-2-methylpropanoate |
| SMILES | COC(=O)C(C)(F)[C@H](c1cccc(O[Si](C)(C)C(C)(C)C)c1)C1CC1 |
| InChI | InChI=1S/C20H31FO3Si/c1-19(2,3)25(6,7)24-16-10-8-9-15(13-16)17(14-11-12-14)20(4,21)18(22)23-5/h8-10,13-14,17H,11-12H2,1-7H3/t17-,20?/m0/s1 |
| InChIKey | NXVDQDBFMHCXPI-DIMJTDRSSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|