C9H8F3NO4S — CID 53465157
[3-(trideuteriomethylcarbamoyl)phenyl] trifluoromethanesulfonate (PubChem CID 53465157) has the molecular formula C9H8F3NO4S and a molecular weight of 286.25 g/mol. Its IUPAC name is [3-(trideuteriomethylcarbamoyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(trideuteriomethylcarbamoyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53465157 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | [3-(trideuteriomethylcarbamoyl)phenyl] trifluoromethanesulfonate |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F3NO4S/c1-13-8(14)6-3-2-4-7(5-6)17-18(15,16)9(10,11)12/h2-5H,1H3,(H,13,14)/i1D3 |
| InChIKey | VNXCEZXZPNISFP-FIBGUPNXSA-N |
| XLogP | 1.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|