C16H16F3NO4S2 — CID 175097839
[3-[(5-tert-butylthiophene-2-carbonyl)amino]phenyl] trifluoromethanesulfonate (PubChem CID 175097839) has the molecular formula C16H16F3NO4S2 and a molecular weight of 407.44 g/mol. Its IUPAC name is [3-[(5-tert-butylthiophene-2-carbonyl)amino]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[(5-tert-butylthiophene-2-carbonyl)amino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175097839 |
| Molecular Formula | C16H16F3NO4S2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [3-[(5-tert-butylthiophene-2-carbonyl)amino]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(OS(=O)(=O)C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C16H16F3NO4S2/c1-15(2,3)13-8-7-12(25-13)14(21)20-10-5-4-6-11(9-10)24-26(22,23)16(17,18)19/h4-9H,1-3H3,(H,20,21) |
| InChIKey | MHWAFDSHYIOLRY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|