C21H23FN2O5 — CID 134466591
N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-2-fluorobenzamide (PubChem CID 134466591) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-2-fluorobenzamide.
| Compound Name | N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 134466591 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-2-fluorobenzamide |
| SMILES | C[C@@]1(CN(O)C(=O)c2ccccc2)CO[C@H](CNC(=O)c2ccccc2F)[C@H]1O |
| InChI | InChI=1S/C21H23FN2O5/c1-21(12-24(28)20(27)14-7-3-2-4-8-14)13-29-17(18(21)25)11-23-19(26)15-9-5-6-10-16(15)22/h2-10,17-18,25,28H,11-13H2,1H3,(H,23,26)/t17-,18-,21-/m1/s1 |
| InChIKey | VJGWXAKUYKVPJO-DBXWQHBBSA-N |
| XLogP | 1.85 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|