C21H22F2N2O5 — CID 134466866
N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-3,4-difluorobenzamide (PubChem CID 134466866) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-3,4-difluorobenzamide.
| Compound Name | N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 134466866 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[[(2R,3S,4R)-4-[[benzoyl(hydroxy)amino]methyl]-3-hydroxy-4-methyloxolan-2-yl]methyl]-3,4-difluorobenzamide |
| SMILES | C[C@@]1(CN(O)C(=O)c2ccccc2)CO[C@H](CNC(=O)c2ccc(F)c(F)c2)[C@H]1O |
| InChI | InChI=1S/C21H22F2N2O5/c1-21(11-25(29)20(28)13-5-3-2-4-6-13)12-30-17(18(21)26)10-24-19(27)14-7-8-15(22)16(23)9-14/h2-9,17-18,26,29H,10-12H2,1H3,(H,24,27)/t17-,18-,21-/m1/s1 |
| InChIKey | SEUAFTCOWSLIKD-DBXWQHBBSA-N |
| XLogP | 1.99 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|