C24H26O4 — CID 134469570
(3R,4'S,6'R)-5-[(4-ethoxyphenyl)methyl]-6-ethynyl-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-4'-ol (PubChem CID 134469570) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is (3R,4'S,6'R)-5-[(4-ethoxyphenyl)methyl]-6-ethynyl-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-4'-ol.
| Compound Name | (3R,4'S,6'R)-5-[(4-ethoxyphenyl)methyl]-6-ethynyl-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-4'-ol |
|---|---|
| PubChem CID | 134469570 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (3R,4'S,6'R)-5-[(4-ethoxyphenyl)methyl]-6-ethynyl-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-4'-ol |
| SMILES | C#Cc1cc2c(cc1Cc1ccc(OCC)cc1)[C@]1(C[C@@H](O)C[C@@H](C)O1)OC2 |
| InChI | InChI=1S/C24H26O4/c1-4-18-12-20-15-27-24(14-21(25)10-16(3)28-24)23(20)13-19(18)11-17-6-8-22(9-7-17)26-5-2/h1,6-9,12-13,16,21,25H,5,10-11,14-15H2,2-3H3/t16-,21+,24-/m1/s1 |
| InChIKey | JJINSJMVOWZNMM-FBJLLXQBSA-N |
| XLogP | 3.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|