C6H12N2 — CID 13447029
N,N-dimethyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 13447029) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is N,N-dimethyl-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N,N-dimethyl-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 13447029 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | N,N-dimethyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CN(C)C1=NCCC1 |
| InChI | InChI=1S/C6H12N2/c1-8(2)6-4-3-5-7-6/h3-5H2,1-2H3 |
| InChIKey | PRQMIJVEENXPNQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |