C10H22N2 — CID 525896
N'-butyl-N,N,2-trimethylpropanimidamide (PubChem CID 525896) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-butyl-N,N,2-trimethylpropanimidamide.
| Compound Name | N'-butyl-N,N,2-trimethylpropanimidamide |
|---|---|
| PubChem CID | 525896 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N'-butyl-N,N,2-trimethylpropanimidamide |
| SMILES | CCCC/N=C(\C(C)C)N(C)C |
| InChI | InChI=1S/C10H22N2/c1-6-7-8-11-10(9(2)3)12(4)5/h9H,6-8H2,1-5H3/b11-10+ |
| InChIKey | PNCFMEMCGFYVJL-ZHACJKMWSA-N |
| XLogP | 2.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|