C13H28N2 — CID 525902
N'-heptyl-N,N,2-trimethylpropanimidamide (PubChem CID 525902) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-heptyl-N,N,2-trimethylpropanimidamide.
| Compound Name | N'-heptyl-N,N,2-trimethylpropanimidamide |
|---|---|
| PubChem CID | 525902 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-heptyl-N,N,2-trimethylpropanimidamide |
| SMILES | CCCCCCC/N=C(\C(C)C)N(C)C |
| InChI | InChI=1S/C13H28N2/c1-6-7-8-9-10-11-14-13(12(2)3)15(4)5/h12H,6-11H2,1-5H3/b14-13+ |
| InChIKey | CWPCNOFREFHUHV-BUHFOSPRSA-N |
| XLogP | 3.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|