C24H27ClN4O2 — CID 134470812
ethyl 2-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-2-methylpropanoate (PubChem CID 134470812) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 134470812 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | ethyl 2-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)N1CCN(c2nnc(-c3ccc(Cl)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-4-31-23(30)24(2,3)29-15-13-28(14-16-29)22-20-8-6-5-7-19(20)21(26-27-22)17-9-11-18(25)12-10-17/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | RJXNTKQXCKUDCA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |