C22H22ClN5O3 — CID 134470834
3-amino-4-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-4-oxobutanoic acid (PubChem CID 134470834) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is 3-amino-4-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134470834 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-amino-4-[4-[4-(4-chlorophenyl)phthalazin-1-yl]piperazin-1-yl]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)N1CCN(c2nnc(-c3ccc(Cl)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H22ClN5O3/c23-15-7-5-14(6-8-15)20-16-3-1-2-4-17(16)21(26-25-20)27-9-11-28(12-10-27)22(31)18(24)13-19(29)30/h1-8,18H,9-13,24H2,(H,29,30) |
| InChIKey | SMEFMXHBAJXICI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |