C22H27N2O3P — CID 134471331
ethyl 1-[1-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)ethyl]cyclopropane-1-carboxylate (PubChem CID 134471331) has the molecular formula C22H27N2O3P and a molecular weight of 398.44 g/mol. Its IUPAC name is ethyl 1-[1-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)ethyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[1-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)ethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134471331 |
| Molecular Formula | C22H27N2O3P |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl 1-[1-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)ethyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(C)P2(=O)N(c3ccccc3)CCN2c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N2O3P/c1-3-27-21(25)22(14-15-22)18(2)28(26)23(19-10-6-4-7-11-19)16-17-24(28)20-12-8-5-9-13-20/h4-13,18H,3,14-17H2,1-2H3 |
| InChIKey | SDTMDLAQUVTNCR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|