C21H25N2O2PS — CID 134475546
ethyl (Z)-3-(1,3-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-yl)pent-3-enoate (PubChem CID 134475546) has the molecular formula C21H25N2O2PS and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl (Z)-3-(1,3-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-yl)pent-3-enoate.
| Compound Name | ethyl (Z)-3-(1,3-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-yl)pent-3-enoate |
|---|---|
| PubChem CID | 134475546 |
| Molecular Formula | C21H25N2O2PS |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | ethyl (Z)-3-(1,3-diphenyl-2-sulfanylidene-1,3,2λ5-diazaphospholidin-2-yl)pent-3-enoate |
| SMILES | C/C=C(/CC(=O)OCC)P1(=S)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C21H25N2O2PS/c1-3-20(17-21(24)25-4-2)26(27)22(18-11-7-5-8-12-18)15-16-23(26)19-13-9-6-10-14-19/h3,5-14H,4,15-17H2,1-2H3/b20-3- |
| InChIKey | PKFNISNLOQYKSN-DYUKFFQPSA-N |
| XLogP | 5.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|