C20H23N2O3P — CID 134471325
ethyl (E)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)but-2-enoate (PubChem CID 134471325) has the molecular formula C20H23N2O3P and a molecular weight of 370.39 g/mol. Its IUPAC name is ethyl (E)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)but-2-enoate.
| Compound Name | ethyl (E)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 134471325 |
| Molecular Formula | C20H23N2O3P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl (E)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)P1(=O)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C20H23N2O3P/c1-3-25-20(23)16-17(2)26(24)21(18-10-6-4-7-11-18)14-15-22(26)19-12-8-5-9-13-19/h4-13,16H,3,14-15H2,1-2H3/b17-16+ |
| InChIKey | HAHVZFDSUBGOTO-WUKNDPDISA-N |
| XLogP | 4.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|