C25H32N3O2P — CID 134475134
ethyl 3-cyclohexylidene-3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)propanoate (PubChem CID 134475134) has the molecular formula C25H32N3O2P and a molecular weight of 437.52 g/mol. Its IUPAC name is ethyl 3-cyclohexylidene-3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)propanoate.
| Compound Name | ethyl 3-cyclohexylidene-3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)propanoate |
|---|---|
| PubChem CID | 134475134 |
| Molecular Formula | C25H32N3O2P |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl 3-cyclohexylidene-3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)propanoate |
| SMILES | [H]N=P1(C(CC(=O)OCC)=C2CCCCC2)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C25H32N3O2P/c1-2-30-25(29)20-24(21-12-6-3-7-13-21)31(26)27(22-14-8-4-9-15-22)18-19-28(31)23-16-10-5-11-17-23/h4-5,8-11,14-17,26H,2-3,6-7,12-13,18-20H2,1H3 |
| InChIKey | ICPDRTIVQIYLJR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|