C20H17F4N5O3 — CID 134474124
N-[4-amino-2-(trifluoromethyl)phenyl]-5-fluoro-2-hydroxy-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)benzamide (PubChem CID 134474124) has the molecular formula C20H17F4N5O3 and a molecular weight of 451.38 g/mol. Its IUPAC name is N-[4-amino-2-(trifluoromethyl)phenyl]-5-fluoro-2-hydroxy-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)benzamide.
| Compound Name | N-[4-amino-2-(trifluoromethyl)phenyl]-5-fluoro-2-hydroxy-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 134474124 |
| Molecular Formula | C20H17F4N5O3 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[4-amino-2-(trifluoromethyl)phenyl]-5-fluoro-2-hydroxy-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)benzamide |
| SMILES | Nc1ccc(NC(=O)c2cc(F)c(-n3nc4n(c3=O)CCCC4)cc2O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F4N5O3/c21-13-8-11(18(31)26-14-5-4-10(25)7-12(14)20(22,23)24)16(30)9-15(13)29-19(32)28-6-2-1-3-17(28)27-29/h4-5,7-9,30H,1-3,6,25H2,(H,26,31) |
| InChIKey | HFBUSHGZWNLBOF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|