C20H14ClF3N4O — CID 134476062
6-(3-chlorophenyl)-2-[1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]pyridazin-3-one (PubChem CID 134476062) has the molecular formula C20H14ClF3N4O and a molecular weight of 418.81 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-2-[1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]pyridazin-3-one.
| Compound Name | 6-(3-chlorophenyl)-2-[1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 134476062 |
| Molecular Formula | C20H14ClF3N4O |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 6-(3-chlorophenyl)-2-[1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]pyridazin-3-one |
| SMILES | CC(c1nc2ccc(C(F)(F)F)cc2[nH]1)n1nc(-c2cccc(Cl)c2)ccc1=O |
| InChI | InChI=1S/C20H14ClF3N4O/c1-11(19-25-16-6-5-13(20(22,23)24)10-17(16)26-19)28-18(29)8-7-15(27-28)12-3-2-4-14(21)9-12/h2-11H,1H3,(H,25,26) |
| InChIKey | NDMZAHBIJXQHSV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |