C21H23F3N2O3 — CID 134476711
ethyl (E,5R)-3-[[(S)-amino(phenyl)methyl]amino]-6,6,6-trifluoro-5-hydroxy-5-phenylhex-2-enoate (PubChem CID 134476711) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is ethyl (E,5R)-3-[[(S)-amino(phenyl)methyl]amino]-6,6,6-trifluoro-5-hydroxy-5-phenylhex-2-enoate.
| Compound Name | ethyl (E,5R)-3-[[(S)-amino(phenyl)methyl]amino]-6,6,6-trifluoro-5-hydroxy-5-phenylhex-2-enoate |
|---|---|
| PubChem CID | 134476711 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl (E,5R)-3-[[(S)-amino(phenyl)methyl]amino]-6,6,6-trifluoro-5-hydroxy-5-phenylhex-2-enoate |
| SMILES | CCOC(=O)/C=C(\C[C@@](O)(c1ccccc1)C(F)(F)F)N[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C21H23F3N2O3/c1-2-29-18(27)13-17(26-19(25)15-9-5-3-6-10-15)14-20(28,21(22,23)24)16-11-7-4-8-12-16/h3-13,19,26,28H,2,14,25H2,1H3/b17-13+/t19-,20+/m0/s1 |
| InChIKey | WIBIZDIKMHCFCJ-RMEHMHSISA-N |
| XLogP | 3.52 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|