C11H21N — CID 134478046
(E)-N,2-dimethyl-3-propylhex-3-en-1-imine (PubChem CID 134478046) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (E)-N,2-dimethyl-3-propylhex-3-en-1-imine.
| Compound Name | (E)-N,2-dimethyl-3-propylhex-3-en-1-imine |
|---|---|
| PubChem CID | 134478046 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (E)-N,2-dimethyl-3-propylhex-3-en-1-imine |
| SMILES | CC/C=C(\CCC)C(C)/C=N/C |
| InChI | InChI=1S/C11H21N/c1-5-7-11(8-6-2)10(3)9-12-4/h7,9-10H,5-6,8H2,1-4H3/b11-7+,12-9+ |
| InChIKey | QRBKPFKDINGIHK-HNWKWBPYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|