C22H23F3O2 — CID 134478949
5-[2-(6-ethoxy-3,4,5-trifluorobiphenylen-2-yl)ethyl]-2-methyloxane (PubChem CID 134478949) has the molecular formula C22H23F3O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 5-[2-(6-ethoxy-3,4,5-trifluorobiphenylen-2-yl)ethyl]-2-methyloxane.
| Compound Name | 5-[2-(6-ethoxy-3,4,5-trifluorobiphenylen-2-yl)ethyl]-2-methyloxane |
|---|---|
| PubChem CID | 134478949 |
| Molecular Formula | C22H23F3O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-[2-(6-ethoxy-3,4,5-trifluorobiphenylen-2-yl)ethyl]-2-methyloxane |
| SMILES | CCOc1ccc2c(c1F)-c1c-2cc(CCC2CCC(C)OC2)c(F)c1F |
| InChI | InChI=1S/C22H23F3O2/c1-3-26-17-9-8-15-16-10-14(7-6-13-5-4-12(2)27-11-13)20(23)22(25)19(16)18(15)21(17)24/h8-10,12-13H,3-7,11H2,1-2H3 |
| InChIKey | FHKHQUWQZODQMS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |