C20H17ClN2O — CID 134483403
6-chloro-1-ethyl-8-(4-methoxyphenyl)-9H-pyrido[3,4-b]indole (PubChem CID 134483403) has the molecular formula C20H17ClN2O and a molecular weight of 336.82 g/mol. Its IUPAC name is 6-chloro-1-ethyl-8-(4-methoxyphenyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-ethyl-8-(4-methoxyphenyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134483403 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 6-chloro-1-ethyl-8-(4-methoxyphenyl)-9H-pyrido[3,4-b]indole |
| SMILES | CCc1nccc2c1[nH]c1c(-c3ccc(OC)cc3)cc(Cl)cc12 |
| InChI | InChI=1S/C20H17ClN2O/c1-3-18-20-15(8-9-22-18)17-11-13(21)10-16(19(17)23-20)12-4-6-14(24-2)7-5-12/h4-11,23H,3H2,1-2H3 |
| InChIKey | CNRCZTMSCYTROY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |