C13H15NO5 — CID 134483854
(E)-3-(3-imino-4,5-dimethoxy-2-methyl-6-oxocyclohexa-1,4-dien-1-yl)-2-methylprop-2-enoic acid (PubChem CID 134483854) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (E)-3-(3-imino-4,5-dimethoxy-2-methyl-6-oxocyclohexa-1,4-dien-1-yl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(3-imino-4,5-dimethoxy-2-methyl-6-oxocyclohexa-1,4-dien-1-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 134483854 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (E)-3-(3-imino-4,5-dimethoxy-2-methyl-6-oxocyclohexa-1,4-dien-1-yl)-2-methylprop-2-enoic acid |
| SMILES | [H]/N=C1/C(C)=C(/C=C(\C)C(=O)O)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C13H15NO5/c1-6(13(16)17)5-8-7(2)9(14)11(18-3)12(19-4)10(8)15/h5,14H,1-4H3,(H,16,17)/b6-5+,14-9- |
| InChIKey | AACGGIGDEYPEHP-RLKLUXQTSA-N |
| XLogP | 1.44 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|