C9H9NO3 — CID 169240949
4-imino-5-methoxy-3-methylidenecyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 169240949) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 4-imino-5-methoxy-3-methylidenecyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-imino-5-methoxy-3-methylidenecyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 169240949 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4-imino-5-methoxy-3-methylidenecyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | [H]/N=C1\C(=C)C=C(C(=O)O)C=C1OC |
| InChI | InChI=1S/C9H9NO3/c1-5-3-6(9(11)12)4-7(13-2)8(5)10/h3-4,10H,1H2,2H3,(H,11,12)/b10-8+ |
| InChIKey | WEEWSJVOQSTVAO-CSKARUKUSA-N |
| XLogP | 1.12 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|