About (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine
(4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine (PubChem CID 134485442) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine |
| PubChem CID | 134485442 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine |
| SMILES | C/C=C\C=N\C(C)=C\C(NC)=C(C)C |
| InChI | InChI=1S/C12H20N2/c1-6-7-8-14-11(4)9-12(13-5)10(2)3/h6-9,13H,1-5H3/b7-6-,11-9+,14-8+ |
| InChIKey | YMDLILARKBBVDU-PVRZDCSNSA-N |
| XLogP | 3.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine?
The IUPAC name of (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine (CID 134485442) is (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine.
What is the SMILES notation for (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine?
The canonical SMILES for (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine is C/C=C\C=N\C(C)=C\C(NC)=C(C)C.
What is the InChIKey of (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine?
The InChIKey is YMDLILARKBBVDU-PVRZDCSNSA-N. The full InChI is InChI=1S/C12H20N2/c1-6-7-8-14-11(4)9-12(13-5)10(2)3/h6-9,13H,1-5H3/b7-6-,11-9+,14-8+.
What are the key properties of (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine?
(4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine has a molecular weight of 192.31 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-[[(Z)-but-2-enylidene]amino]-N,2-dimethylhexa-2,4-dien-3-amine is sourced from PubChem (CID 134485442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).