C11H20N2 — CID 134485786
N-methyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-3-amine (PubChem CID 134485786) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N-methyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-3-amine.
| Compound Name | N-methyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 134485786 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-methyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-3-amine |
| SMILES | C=C(/C=C\C)N1CCCC(NC)C1 |
| InChI | InChI=1S/C11H20N2/c1-4-6-10(2)13-8-5-7-11(9-13)12-3/h4,6,11-12H,2,5,7-9H2,1,3H3/b6-4- |
| InChIKey | ACPKKEDCIWSNAG-XQRVVYSFSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|