C20H19N3O3 — CID 134485802
[7-(3-hydroxyoxiran-2-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 134485802) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is [7-(3-hydroxyoxiran-2-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | [7-(3-hydroxyoxiran-2-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 134485802 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [7-(3-hydroxyoxiran-2-yl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc2nccc(C3OC3O)c2[nH]1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H19N3O3/c24-19(23-9-7-13(11-23)12-4-2-1-3-5-12)16-10-15-17(22-16)14(6-8-21-15)18-20(25)26-18/h1-6,8,10,13,18,20,22,25H,7,9,11H2 |
| InChIKey | CFSNOQIVLORCLN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|