C19H18N2O2 — CID 154872305
(3-methyl-1,2-benzoxazol-6-yl)-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 154872305) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3-methyl-1,2-benzoxazol-6-yl)-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (3-methyl-1,2-benzoxazol-6-yl)-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 154872305 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3-methyl-1,2-benzoxazol-6-yl)-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | Cc1noc2cc(C(=O)N3CCC(c4ccccc4)C3)ccc12 |
| InChI | InChI=1S/C19H18N2O2/c1-13-17-8-7-15(11-18(17)23-20-13)19(22)21-10-9-16(12-21)14-5-3-2-4-6-14/h2-8,11,16H,9-10,12H2,1H3 |
| InChIKey | UNCMQTHIMGPJCO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |