C29H27F5N2O3S — CID 134488274
(3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide (PubChem CID 134488274) has the molecular formula C29H27F5N2O3S and a molecular weight of 578.60 g/mol. Its IUPAC name is (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 134488274 |
| Molecular Formula | C29H27F5N2O3S |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@@H]1[C@H](C(=O)NCc3ccncc3)CC[C@]21S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H27F5N2O3S/c1-27(31,29(32,33)34)20-3-9-24-19(16-20)2-8-25-23(26(37)36-17-18-11-14-35-15-12-18)10-13-28(24,25)40(38,39)22-6-4-21(30)5-7-22/h3-7,9,11-12,14-16,23,25H,2,8,10,13,17H2,1H3,(H,36,37)/t23-,25-,27?,28+/m1/s1 |
| InChIKey | SNIRUUDBIJEBGG-BULXBJIFSA-N |
| XLogP | 5.93 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |