C28H29F5N2O4S — CID 134488308
4-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carbonyl]-1-methylpiperazin-2-one (PubChem CID 134488308) has the molecular formula C28H29F5N2O4S and a molecular weight of 584.61 g/mol. Its IUPAC name is 4-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carbonyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carbonyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 134488308 |
| Molecular Formula | C28H29F5N2O4S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 4-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carbonyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(C)(F)C(F)(F)F)cc4CC[C@@H]23)CC1=O |
| InChI | InChI=1S/C28H29F5N2O4S/c1-26(30,28(31,32)33)18-4-10-22-17(15-18)3-9-23-21(25(37)35-14-13-34(2)24(36)16-35)11-12-27(22,23)40(38,39)20-7-5-19(29)6-8-20/h4-8,10,15,21,23H,3,9,11-14,16H2,1-2H3/t21-,23+,26?,27-/m1/s1 |
| InChIKey | LQTIIJBVPSAOCY-BUOCFGIJSA-N |
| XLogP | 4.51 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |