C31H34F5NO4S — CID 158838260
2-[(3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-(1-acetylpiperidin-4-yl)ethanone (PubChem CID 158838260) has the molecular formula C31H34F5NO4S and a molecular weight of 611.67 g/mol. Its IUPAC name is 2-[(3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-(1-acetylpiperidin-4-yl)ethanone.
| Compound Name | 2-[(3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-(1-acetylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 158838260 |
| Molecular Formula | C31H34F5NO4S |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 2-[(3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1-(1-acetylpiperidin-4-yl)ethanone |
| SMILES | CC(=O)N1CCC(C(=O)C[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(C)(F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C31H34F5NO4S/c1-19(38)37-15-12-20(13-16-37)28(39)18-22-11-14-30(42(40,41)25-7-5-24(32)6-8-25)26(22)9-3-21-17-23(4-10-27(21)30)29(2,33)31(34,35)36/h4-8,10,17,20,22,26H,3,9,11-16,18H2,1-2H3/t22-,26-,29?,30-/m0/s1 |
| InChIKey | IXXHLUHSSGVSRW-ATIQLLDLSA-N |
| XLogP | 6.43 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |