C27H28F5NO5S2 — CID 134488279
(3R,3aS,9bS)-N-(1,1-dioxothiolan-3-yl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide (PubChem CID 134488279) has the molecular formula C27H28F5NO5S2 and a molecular weight of 605.65 g/mol. Its IUPAC name is (3R,3aS,9bS)-N-(1,1-dioxothiolan-3-yl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R,3aS,9bS)-N-(1,1-dioxothiolan-3-yl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 134488279 |
| Molecular Formula | C27H28F5NO5S2 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | (3R,3aS,9bS)-N-(1,1-dioxothiolan-3-yl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1[C@H](C(=O)NC3CCS(=O)(=O)C3)CC[C@@]21S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H28F5NO5S2/c1-25(29,27(30,31)32)17-3-9-22-16(14-17)2-8-23-21(24(34)33-19-11-13-39(35,36)15-19)10-12-26(22,23)40(37,38)20-6-4-18(28)5-7-20/h3-7,9,14,19,21,23H,2,8,10-13,15H2,1H3,(H,33,34)/t19?,21-,23+,25?,26-/m1/s1 |
| InChIKey | XWGVDZWIWSSPDT-QLFBHGQTSA-N |
| XLogP | 4.52 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |