C27H27F8NO4S2 — CID 164616982
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothian-4-amine (PubChem CID 164616982) has the molecular formula C27H27F8NO4S2 and a molecular weight of 645.63 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 164616982 |
| Molecular Formula | C27H27F8NO4S2 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(N[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C27H27F8NO4S2/c28-18-3-5-20(6-4-18)42(39,40)24-12-9-23(36-19-10-13-41(37,38)14-11-19)22(24)7-1-16-15-17(2-8-21(16)24)25(29,26(30,31)32)27(33,34)35/h2-6,8,15,19,22-23,36H,1,7,9-14H2/t22-,23+,24+/m0/s1 |
| InChIKey | XEVGQAWENLOSKD-RBZQAINGSA-N |
| XLogP | 5.68 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |