C28H27F8NO5S — CID 134491505
3-[[(3R,3aS,10bS)-10b-(4-fluorophenyl)sulfonyl-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[e]azulen-3-yl]amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 134491505) has the molecular formula C28H27F8NO5S and a molecular weight of 641.58 g/mol. Its IUPAC name is 3-[[(3R,3aS,10bS)-10b-(4-fluorophenyl)sulfonyl-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[e]azulen-3-yl]amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[[(3R,3aS,10bS)-10b-(4-fluorophenyl)sulfonyl-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[e]azulen-3-yl]amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 134491505 |
| Molecular Formula | C28H27F8NO5S |
| Molecular Weight | 641.58 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | 3-[[(3R,3aS,10bS)-10b-(4-fluorophenyl)sulfonyl-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[e]azulen-3-yl]amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC[C@@H]12 |
| InChI | InChI=1S/C28H27F8NO5S/c1-24(2,23(39)40)22(38)37-21-12-13-25(43(41,42)18-9-7-17(29)8-10-18)19-11-6-16(14-15(19)4-3-5-20(21)25)26(30,27(31,32)33)28(34,35)36/h6-11,14,20-21H,3-5,12-13H2,1-2H3,(H,37,38)(H,39,40)/t20-,21+,25+/m0/s1 |
| InChIKey | MMSKULCGPOGMTA-BPYKYCOYSA-N |
| XLogP | 6.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|