C24H23F8NO2S — CID 134510911
1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]ethanamine (PubChem CID 134510911) has the molecular formula C24H23F8NO2S and a molecular weight of 541.50 g/mol. Its IUPAC name is 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]ethanamine.
| Compound Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]ethanamine |
|---|---|
| PubChem CID | 134510911 |
| Molecular Formula | C24H23F8NO2S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]ethanamine |
| SMILES | CC(N)[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H23F8NO2S/c1-13(33)18-10-11-21(36(34,35)17-6-4-16(25)5-7-17)19-9-3-15(12-14(19)2-8-20(18)21)22(26,23(27,28)29)24(30,31)32/h3-7,9,12-13,18,20H,2,8,10-11,33H2,1H3/t13?,18-,20-,21+/m0/s1 |
| InChIKey | LAIORGULNNRTSP-WLCDPWHKSA-N |
| XLogP | 6.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |