C22H20F7NO2S — CID 122678673
7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122678673) has the molecular formula C22H20F7NO2S and a molecular weight of 495.46 g/mol. Its IUPAC name is 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122678673 |
| Molecular Formula | C22H20F7NO2S |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | Cc1ccc(S(=O)(=O)C23CCNC2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C22H20F7NO2S/c1-13-2-6-16(7-3-13)33(31,32)19-10-11-30-18(19)9-4-14-12-15(5-8-17(14)19)20(23,21(24,25)26)22(27,28)29/h2-3,5-8,12,18,30H,4,9-11H2,1H3 |
| InChIKey | YEIGJYVXLRNANO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |