C21H18Cl2F7NO2S — CID 122669241
9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride (PubChem CID 122669241) has the molecular formula C21H18Cl2F7NO2S and a molecular weight of 552.34 g/mol. Its IUPAC name is 9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride.
| Compound Name | 9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
|---|---|
| PubChem CID | 122669241 |
| Molecular Formula | C21H18Cl2F7NO2S |
| Molecular Weight | 552.34 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(Cl)cc1)C12CCNC1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H17ClF7NO2S.ClH/c22-14-3-5-15(6-4-14)33(31,32)18-9-10-30-17(18)8-1-12-11-13(2-7-16(12)18)19(23,20(24,25)26)21(27,28)29;/h2-7,11,17,30H,1,8-10H2;1H |
| InChIKey | GLSXVVNOKPTTJW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.34 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |