C20H16F8N2O2S — CID 134442530
9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5,6,6a,7,8,9-hexahydropyrrolo[2,3-h]isoquinoline (PubChem CID 134442530) has the molecular formula C20H16F8N2O2S and a molecular weight of 500.41 g/mol. Its IUPAC name is 9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5,6,6a,7,8,9-hexahydropyrrolo[2,3-h]isoquinoline.
| Compound Name | 9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5,6,6a,7,8,9-hexahydropyrrolo[2,3-h]isoquinoline |
|---|---|
| PubChem CID | 134442530 |
| Molecular Formula | C20H16F8N2O2S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 9a-(4-fluorophenyl)sulfonyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5,6,6a,7,8,9-hexahydropyrrolo[2,3-h]isoquinoline |
| SMILES | O=S(=O)(c1ccc(F)cc1)C12CCNC1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ncc12 |
| InChI | InChI=1S/C20H16F8N2O2S/c21-12-2-4-13(5-3-12)33(31,32)17-7-8-29-15(17)6-1-11-9-16(30-10-14(11)17)18(22,19(23,24)25)20(26,27)28/h2-5,9-10,15,29H,1,6-8H2 |
| InChIKey | LTALXNAEDSUNJZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |